C17H18O6S — CID 90246339
3-[(4-oxo-1-adamantyl)oxycarbonyl]benzenesulfonic acid (PubChem CID 90246339) has the molecular formula C17H18O6S and a molecular weight of 350.39 g/mol. Its IUPAC name is 3-[(4-oxo-1-adamantyl)oxycarbonyl]benzenesulfonic acid.
| Compound Name | 3-[(4-oxo-1-adamantyl)oxycarbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90246339 |
| Molecular Formula | C17H18O6S |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 3-[(4-oxo-1-adamantyl)oxycarbonyl]benzenesulfonic acid |
| SMILES | O=C(OC12CC3CC(C1)C(=O)C(C3)C2)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C17H18O6S/c18-15-12-4-10-5-13(15)9-17(7-10,8-12)23-16(19)11-2-1-3-14(6-11)24(20,21)22/h1-3,6,10,12-13H,4-5,7-9H2,(H,20,21,22) |
| InChIKey | ZCACGZNVUFICLX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|