About 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate
2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate (PubChem CID 162451074) has the molecular formula C19H19F2O5-
and a molecular weight of 365.35 g/mol. Its IUPAC name is 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate.
Molecular Properties
| Compound Name | 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate |
| PubChem CID | 162451074 |
| Molecular Formula | C19H19F2O5- |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate |
| SMILES | O=C(OC12CC3CC(CC(C3)C1)C2)c1ccc(OC(F)(F)C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H20F2O5/c20-19(21,17(23)24)25-15-3-1-14(2-4-15)16(22)26-18-8-11-5-12(9-18)7-13(6-11)10-18/h1-4,11-13H,5-10H2,(H,23,24)/p-1 |
| InChIKey | FWSXAEWOUGZEFS-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate?
The IUPAC name of 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate (CID 162451074) is 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate.
What is the SMILES notation for 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate?
The canonical SMILES for 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate is O=C(OC12CC3CC(CC(C3)C1)C2)c1ccc(OC(F)(F)C(=O)[O-])cc1.
What is the InChIKey of 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate?
The InChIKey is FWSXAEWOUGZEFS-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H20F2O5/c20-19(21,17(23)24)25-15-3-1-14(2-4-15)16(22)26-18-8-11-5-12(9-18)7-13(6-11)10-18/h1-4,11-13H,5-10H2,(H,23,24)/p-1.
What are the key properties of 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate?
2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate has a molecular weight of 365.35 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1-adamantyloxycarbonyl)phenoxy]-2,2-difluoroacetate is sourced from PubChem (CID 162451074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).