C14H8F3O3- — CID 162451027
2,2-difluoro-2-[4-(4-fluorophenyl)phenoxy]acetate (PubChem CID 162451027) has the molecular formula C14H8F3O3- and a molecular weight of 281.21 g/mol. Its IUPAC name is 2,2-difluoro-2-[4-(4-fluorophenyl)phenoxy]acetate.
| Compound Name | 2,2-difluoro-2-[4-(4-fluorophenyl)phenoxy]acetate |
|---|---|
| PubChem CID | 162451027 |
| Molecular Formula | C14H8F3O3- |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2,2-difluoro-2-[4-(4-fluorophenyl)phenoxy]acetate |
| SMILES | O=C([O-])C(F)(F)Oc1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C14H9F3O3/c15-11-5-1-9(2-6-11)10-3-7-12(8-4-10)20-14(16,17)13(18)19/h1-8H,(H,18,19)/p-1 |
| InChIKey | KQWMDCHZTMFSGB-UHFFFAOYSA-M |
| XLogP | 2.21 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |