C27H28N2O4 — CID 67870616
tert-butyl 5-benzoyl-4-(naphthalene-2-carbonylamino)pyrrolidine-3-carboxylate (PubChem CID 67870616) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is tert-butyl 5-benzoyl-4-(naphthalene-2-carbonylamino)pyrrolidine-3-carboxylate.
| Compound Name | tert-butyl 5-benzoyl-4-(naphthalene-2-carbonylamino)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 67870616 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | tert-butyl 5-benzoyl-4-(naphthalene-2-carbonylamino)pyrrolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CNC(C(=O)c2ccccc2)C1NC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H28N2O4/c1-27(2,3)33-26(32)21-16-28-23(24(30)18-10-5-4-6-11-18)22(21)29-25(31)20-14-13-17-9-7-8-12-19(17)15-20/h4-15,21-23,28H,16H2,1-3H3,(H,29,31) |
| InChIKey | USHQAVYKMQBKFJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |