C24H23NO2 — CID 24865488
methyl (2S,3R)-3-methyl-1-tritylaziridine-2-carboxylate (PubChem CID 24865488) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl (2S,3R)-3-methyl-1-tritylaziridine-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-methyl-1-tritylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 24865488 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | methyl (2S,3R)-3-methyl-1-tritylaziridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](C)N1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO2/c1-18-22(23(26)27-2)25(18)24(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-18,22H,1-2H3/t18-,22+,25?/m1/s1 |
| InChIKey | BVGNONFOZJRWNA-IIAXJLLOSA-N |
| XLogP | 4.22 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|