C24H14F4O3 — CID 10598495
(1S,2S,3R,6S,7R,8R)-10,11,12,13-tetrafluoro-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione (PubChem CID 10598495) has the molecular formula C24H14F4O3 and a molecular weight of 426.37 g/mol. Its IUPAC name is (1S,2S,3R,6S,7R,8R)-10,11,12,13-tetrafluoro-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione.
| Compound Name | (1S,2S,3R,6S,7R,8R)-10,11,12,13-tetrafluoro-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione |
|---|---|
| PubChem CID | 10598495 |
| Molecular Formula | C24H14F4O3 |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (1S,2S,3R,6S,7R,8R)-10,11,12,13-tetrafluoro-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione |
| SMILES | O=C1OC(=O)[C@]23[C@H]4c5ccccc5[C@H](c5c(F)c(F)c(F)c(F)c54)[C@]12[C@H]1C=C[C@@H]3CC1 |
| InChI | InChI=1S/C24H14F4O3/c25-17-13-14(18(26)20(28)19(17)27)16-12-4-2-1-3-11(12)15(13)23-9-5-7-10(8-6-9)24(16,23)22(30)31-21(23)29/h1-5,7,9-10,15-16H,6,8H2/t9-,10+,15+,16-,23+,24- |
| InChIKey | PJQUQWAQEMGGOL-WVFLEQDLSA-N |
| XLogP | 4.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|