C25H20O4 — CID 10762580
(1R,2R,3R,6S,7R,8S)-11-methoxy-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione (PubChem CID 10762580) has the molecular formula C25H20O4 and a molecular weight of 384.43 g/mol. Its IUPAC name is (1R,2R,3R,6S,7R,8S)-11-methoxy-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione.
| Compound Name | (1R,2R,3R,6S,7R,8S)-11-methoxy-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione |
|---|---|
| PubChem CID | 10762580 |
| Molecular Formula | C25H20O4 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (1R,2R,3R,6S,7R,8S)-11-methoxy-22-oxaheptacyclo[6.6.6.32,7.23,6.02,7.09,14.015,20]pentacosa-4,9(14),10,12,15,17,19-heptaene-21,23-dione |
| SMILES | COc1ccc2c(c1)[C@@H]1c3ccccc3[C@H]2[C@@]23C(=O)OC(=O)[C@]12[C@@H]1C=C[C@H]3CC1 |
| InChI | InChI=1S/C25H20O4/c1-28-15-10-11-18-19(12-15)21-17-5-3-2-4-16(17)20(18)24-13-6-8-14(9-7-13)25(21,24)23(27)29-22(24)26/h2-6,8,10-14,20-21H,7,9H2,1H3/t13-,14+,20+,21-,24-,25-/m0/s1 |
| InChIKey | SMXKBORJXBSTHK-YTQUSDGBSA-N |
| XLogP | 3.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|