C16H18O3 — CID 101242052
(1R,8S,10R)-4-methoxy-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-15-one (PubChem CID 101242052) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (1R,8S,10R)-4-methoxy-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-15-one.
| Compound Name | (1R,8S,10R)-4-methoxy-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-15-one |
|---|---|
| PubChem CID | 101242052 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (1R,8S,10R)-4-methoxy-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2(7),3,5-trien-15-one |
| SMILES | COc1ccc2c(c1)[C@@]13CCCC[C@@H]1C[C@@H]2OC3=O |
| InChI | InChI=1S/C16H18O3/c1-18-11-5-6-12-13(9-11)16-7-3-2-4-10(16)8-14(12)19-15(16)17/h5-6,9-10,14H,2-4,7-8H2,1H3/t10-,14+,16-/m1/s1 |
| InChIKey | XZEVMRRGLOGTFA-FUEDEBDSSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |