C17H23NO2 — CID 21330649
5a-(3-methoxyphenyl)-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[c]azepin-3-one (PubChem CID 21330649) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 5a-(3-methoxyphenyl)-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[c]azepin-3-one.
| Compound Name | 5a-(3-methoxyphenyl)-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[c]azepin-3-one |
|---|---|
| PubChem CID | 21330649 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 5a-(3-methoxyphenyl)-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[c]azepin-3-one |
| SMILES | COc1cccc(C23CCCCC2CNC(=O)CC3)c1 |
| InChI | InChI=1S/C17H23NO2/c1-20-15-7-4-6-13(11-15)17-9-3-2-5-14(17)12-18-16(19)8-10-17/h4,6-7,11,14H,2-3,5,8-10,12H2,1H3,(H,18,19) |
| InChIKey | LKUMXIGCBXQQJH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |