C21H33NO — CID 22824824
(4aS,8aS)-4a-(3-methoxyphenyl)-2-pentyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline (PubChem CID 22824824) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (4aS,8aS)-4a-(3-methoxyphenyl)-2-pentyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline.
| Compound Name | (4aS,8aS)-4a-(3-methoxyphenyl)-2-pentyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
|---|---|
| PubChem CID | 22824824 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (4aS,8aS)-4a-(3-methoxyphenyl)-2-pentyl-1,3,4,5,6,7,8,8a-octahydroisoquinoline |
| SMILES | CCCCCN1CC[C@@]2(c3cccc(OC)c3)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C21H33NO/c1-3-4-7-14-22-15-13-21(12-6-5-9-19(21)17-22)18-10-8-11-20(16-18)23-2/h8,10-11,16,19H,3-7,9,12-15,17H2,1-2H3/t19-,21-/m1/s1 |
| InChIKey | AECPSKLSKFFWKA-TZIWHRDSSA-N |
| XLogP | 5.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|