C23H38BrNO — CID 20534400
4a-(3-methoxyphenyl)-2-octyl-1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium bromide (PubChem CID 20534400) has the molecular formula C23H38BrNO and a molecular weight of 424.47 g/mol. Its IUPAC name is 4a-(3-methoxyphenyl)-2-octyl-1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium bromide.
| Compound Name | 4a-(3-methoxyphenyl)-2-octyl-1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium bromide |
|---|---|
| PubChem CID | 20534400 |
| Molecular Formula | C23H38BrNO |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 4a-(3-methoxyphenyl)-2-octyl-1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium bromide |
| SMILES | CCCCCCCC[NH+]1CCC2(c3cccc(OC)c3)CCCC2C1.[Br-] |
| InChI | InChI=1S/C23H37NO.BrH/c1-3-4-5-6-7-8-16-24-17-15-23(14-10-12-21(23)19-24)20-11-9-13-22(18-20)25-2;/h9,11,13,18,21H,3-8,10,12,14-17,19H2,1-2H3;1H |
| InChIKey | ZZBWLPLWQAPSLI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|