C17H26BrNO — CID 74070212
7-ethyl-1-(3-methoxyphenyl)-6-methyl-6-azabicyclo[3.2.1]octane;hydrobromide (PubChem CID 74070212) has the molecular formula C17H26BrNO and a molecular weight of 340.31 g/mol. Its IUPAC name is 7-ethyl-1-(3-methoxyphenyl)-6-methyl-6-azabicyclo[3.2.1]octane;hydrobromide.
| Compound Name | 7-ethyl-1-(3-methoxyphenyl)-6-methyl-6-azabicyclo[3.2.1]octane;hydrobromide |
|---|---|
| PubChem CID | 74070212 |
| Molecular Formula | C17H26BrNO |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 7-ethyl-1-(3-methoxyphenyl)-6-methyl-6-azabicyclo[3.2.1]octane;hydrobromide |
| SMILES | Br.CCC1N(C)C2CCCC1(c1cccc(OC)c1)C2 |
| InChI | InChI=1S/C17H25NO.BrH/c1-4-16-17(10-6-8-14(12-17)18(16)2)13-7-5-9-15(11-13)19-3;/h5,7,9,11,14,16H,4,6,8,10,12H2,1-3H3;1H |
| InChIKey | NMGQCDDVTXNZIZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |