C48H60N2O8 — CID 20534447
butanedioate;bis(3-[2-[(2-methylphenoxy)methyl]-1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium-4a-yl]phenol) (PubChem CID 20534447) has the molecular formula C48H60N2O8 and a molecular weight of 793.01 g/mol. Its IUPAC name is butanedioate;bis(3-[2-[(2-methylphenoxy)methyl]-1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium-4a-yl]phenol).
| Compound Name | butanedioate;bis(3-[2-[(2-methylphenoxy)methyl]-1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium-4a-yl]phenol) |
|---|---|
| PubChem CID | 20534447 |
| Molecular Formula | C48H60N2O8 |
| Molecular Weight | 793.01 g/mol |
| Exact Mass | 792.43 |
| IUPAC Name | butanedioate;bis(3-[2-[(2-methylphenoxy)methyl]-1,2,3,4,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-ium-4a-yl]phenol) |
| SMILES | Cc1ccccc1OC[NH+]1CCC2(c3cccc(O)c3)CCCC2C1.Cc1ccccc1OC[NH+]1CCC2(c3cccc(O)c3)CCCC2C1.O=C([O-])CCC(=O)[O-] |
| InChI | InChI=1S/2C22H27NO2.C4H6O4/c2*1-17-6-2-3-10-21(17)25-16-23-13-12-22(11-5-8-19(22)15-23)18-7-4-9-20(24)14-18;5-3(6)1-2-4(7)8/h2*2-4,6-7,9-10,14,19,24H,5,8,11-13,15-16H2,1H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | AUEKIPHTSMNJFE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.01 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |