C24H31NO2 — CID 86754625
(4aS,8aR)-2-ethyl-4a-(3-methoxyphenyl)-6-phenyl-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-ol (PubChem CID 86754625) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (4aS,8aR)-2-ethyl-4a-(3-methoxyphenyl)-6-phenyl-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-ol.
| Compound Name | (4aS,8aR)-2-ethyl-4a-(3-methoxyphenyl)-6-phenyl-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 86754625 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (4aS,8aR)-2-ethyl-4a-(3-methoxyphenyl)-6-phenyl-3,4,5,7,8,8a-hexahydro-1H-isoquinolin-6-ol |
| SMILES | CCN1CC[C@]2(c3cccc(OC)c3)CC(O)(c3ccccc3)CC[C@H]2C1 |
| InChI | InChI=1S/C24H31NO2/c1-3-25-15-14-23(20-10-7-11-22(16-20)27-2)18-24(26,13-12-21(23)17-25)19-8-5-4-6-9-19/h4-11,16,21,26H,3,12-15,17-18H2,1-2H3/t21-,23+,24?/m0/s1 |
| InChIKey | KBQRLXDCUNLTDP-AZIDCLHTSA-N |
| XLogP | 4.35 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |