C23H27NO — CID 86754627
3-[(4aR,8aR)-2-ethyl-6-phenyl-1,3,4,5,8,8a-hexahydroisoquinolin-4a-yl]phenol (PubChem CID 86754627) has the molecular formula C23H27NO and a molecular weight of 333.48 g/mol. Its IUPAC name is 3-[(4aR,8aR)-2-ethyl-6-phenyl-1,3,4,5,8,8a-hexahydroisoquinolin-4a-yl]phenol.
| Compound Name | 3-[(4aR,8aR)-2-ethyl-6-phenyl-1,3,4,5,8,8a-hexahydroisoquinolin-4a-yl]phenol |
|---|---|
| PubChem CID | 86754627 |
| Molecular Formula | C23H27NO |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-[(4aR,8aR)-2-ethyl-6-phenyl-1,3,4,5,8,8a-hexahydroisoquinolin-4a-yl]phenol |
| SMILES | CCN1CC[C@]2(c3cccc(O)c3)CC(c3ccccc3)=CC[C@H]2C1 |
| InChI | InChI=1S/C23H27NO/c1-2-24-14-13-23(20-9-6-10-22(25)15-20)16-19(11-12-21(23)17-24)18-7-4-3-5-8-18/h3-11,15,21,25H,2,12-14,16-17H2,1H3/t21-,23+/m0/s1 |
| InChIKey | MVCSOCCGZNMXJU-JTHBVZDNSA-N |
| XLogP | 4.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |