C26H29NO — CID 18393149
(4aS,8aS)-2-ethyl-4a-(3-methoxyphenyl)-6-(2-phenylethynyl)-1,3,4,5,8,8a-hexahydroisoquinoline (PubChem CID 18393149) has the molecular formula C26H29NO and a molecular weight of 371.52 g/mol. Its IUPAC name is (4aS,8aS)-2-ethyl-4a-(3-methoxyphenyl)-6-(2-phenylethynyl)-1,3,4,5,8,8a-hexahydroisoquinoline.
| Compound Name | (4aS,8aS)-2-ethyl-4a-(3-methoxyphenyl)-6-(2-phenylethynyl)-1,3,4,5,8,8a-hexahydroisoquinoline |
|---|---|
| PubChem CID | 18393149 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (4aS,8aS)-2-ethyl-4a-(3-methoxyphenyl)-6-(2-phenylethynyl)-1,3,4,5,8,8a-hexahydroisoquinoline |
| SMILES | CCN1CC[C@@]2(c3cccc(OC)c3)CC(C#Cc3ccccc3)=CC[C@@H]2C1 |
| InChI | InChI=1S/C26H29NO/c1-3-27-17-16-26(23-10-7-11-25(18-23)28-2)19-22(14-15-24(26)20-27)13-12-21-8-5-4-6-9-21/h4-11,14,18,24H,3,15-17,19-20H2,1-2H3/t24-,26+/m1/s1 |
| InChIKey | APFDFRXYLSIQRJ-RSXGOPAZSA-N |
| XLogP | 5.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|