C16H25NO — CID 18393824
(3R,4S)-1-ethyl-4-(3-methoxyphenyl)-3,4-dimethylpiperidine (PubChem CID 18393824) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (3R,4S)-1-ethyl-4-(3-methoxyphenyl)-3,4-dimethylpiperidine.
| Compound Name | (3R,4S)-1-ethyl-4-(3-methoxyphenyl)-3,4-dimethylpiperidine |
|---|---|
| PubChem CID | 18393824 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (3R,4S)-1-ethyl-4-(3-methoxyphenyl)-3,4-dimethylpiperidine |
| SMILES | CCN1CC[C@](C)(c2cccc(OC)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C16H25NO/c1-5-17-10-9-16(3,13(2)12-17)14-7-6-8-15(11-14)18-4/h6-8,11,13H,5,9-10,12H2,1-4H3/t13-,16-/m0/s1 |
| InChIKey | XIAOLHYHQIQMRP-BBRMVZONSA-N |
| XLogP | 3.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |