C19H30BrNO — CID 70588527
(3R,4R)-4-(3-methoxyphenyl)-3-methyl-1-prop-2-enyl-4-propylpiperidine;hydrobromide (PubChem CID 70588527) has the molecular formula C19H30BrNO and a molecular weight of 368.36 g/mol. Its IUPAC name is (3R,4R)-4-(3-methoxyphenyl)-3-methyl-1-prop-2-enyl-4-propylpiperidine;hydrobromide.
| Compound Name | (3R,4R)-4-(3-methoxyphenyl)-3-methyl-1-prop-2-enyl-4-propylpiperidine;hydrobromide |
|---|---|
| PubChem CID | 70588527 |
| Molecular Formula | C19H30BrNO |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (3R,4R)-4-(3-methoxyphenyl)-3-methyl-1-prop-2-enyl-4-propylpiperidine;hydrobromide |
| SMILES | Br.C=CCN1CC[C@@](CCC)(c2cccc(OC)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C19H29NO.BrH/c1-5-10-19(17-8-7-9-18(14-17)21-4)11-13-20(12-6-2)15-16(19)3;/h6-9,14,16H,2,5,10-13,15H2,1,3-4H3;1H/t16-,19+;/m0./s1 |
| InChIKey | BNGCVGPADPFEDJ-ZKKBRJJYSA-N |
| XLogP | 4.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|