C40H62N2O6 — CID 70577501
(Z)-but-2-enedioate;bis(4-(3-methoxyphenyl)-1,2,5-trimethyl-4-propylpiperidin-1-ium) (PubChem CID 70577501) has the molecular formula C40H62N2O6 and a molecular weight of 666.94 g/mol. Its IUPAC name is (Z)-but-2-enedioate;bis(4-(3-methoxyphenyl)-1,2,5-trimethyl-4-propylpiperidin-1-ium).
| Compound Name | (Z)-but-2-enedioate;bis(4-(3-methoxyphenyl)-1,2,5-trimethyl-4-propylpiperidin-1-ium) |
|---|---|
| PubChem CID | 70577501 |
| Molecular Formula | C40H62N2O6 |
| Molecular Weight | 666.94 g/mol |
| Exact Mass | 666.46 |
| IUPAC Name | (Z)-but-2-enedioate;bis(4-(3-methoxyphenyl)-1,2,5-trimethyl-4-propylpiperidin-1-ium) |
| SMILES | CCCC1(c2cccc(OC)c2)CC(C)[NH+](C)CC1C.CCCC1(c2cccc(OC)c2)CC(C)[NH+](C)CC1C.O=C([O-])/C=C\C(=O)[O-] |
| InChI | InChI=1S/2C18H29NO.C4H4O4/c2*1-6-10-18(12-15(3)19(4)13-14(18)2)16-8-7-9-17(11-16)20-5;5-3(6)1-2-4(7)8/h2*7-9,11,14-15H,6,10,12-13H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | FXGXJLKILDSMQD-KSBRXOFISA-N |
| XLogP | 2.39 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.94 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|