C36H52N2O6+2 — CID 88772380
bis[4-(3-methoxyphenyl)-1,2,4,5-tetramethylpiperidin-1-ium-1-yl] (Z)-but-2-enedioate (PubChem CID 88772380) has the molecular formula C36H52N2O6+2 and a molecular weight of 608.82 g/mol. Its IUPAC name is bis[4-(3-methoxyphenyl)-1,2,4,5-tetramethylpiperidin-1-ium-1-yl] (Z)-but-2-enedioate.
| Compound Name | bis[4-(3-methoxyphenyl)-1,2,4,5-tetramethylpiperidin-1-ium-1-yl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 88772380 |
| Molecular Formula | C36H52N2O6+2 |
| Molecular Weight | 608.82 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | bis[4-(3-methoxyphenyl)-1,2,4,5-tetramethylpiperidin-1-ium-1-yl] (Z)-but-2-enedioate |
| SMILES | COc1cccc(C2(C)CC(C)[N+](C)(OC(=O)/C=C\C(=O)O[N+]3(C)CC(C)C(C)(c4cccc(OC)c4)CC3C)CC2C)c1 |
| InChI | InChI=1S/C36H52N2O6/c1-25-23-37(7,27(3)21-35(25,5)29-13-11-15-31(19-29)41-9)43-33(39)17-18-34(40)44-38(8)24-26(2)36(6,22-28(38)4)30-14-12-16-32(20-30)42-10/h11-20,25-28H,21-24H2,1-10H3/q+2/b18-17- |
| InChIKey | CODHGMFIJWEILT-ZCXUNETKSA-N |
| XLogP | 6.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.82 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|