C21H26NO2+ — CID 7071864
[(2S,4S,5R)-1,2,5-trimethyl-4-phenylpiperidin-1-ium-4-yl] benzoate (PubChem CID 7071864) has the molecular formula C21H26NO2+ and a molecular weight of 324.44 g/mol. Its IUPAC name is [(2S,4S,5R)-1,2,5-trimethyl-4-phenylpiperidin-1-ium-4-yl] benzoate.
| Compound Name | [(2S,4S,5R)-1,2,5-trimethyl-4-phenylpiperidin-1-ium-4-yl] benzoate |
|---|---|
| PubChem CID | 7071864 |
| Molecular Formula | C21H26NO2+ |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [(2S,4S,5R)-1,2,5-trimethyl-4-phenylpiperidin-1-ium-4-yl] benzoate |
| SMILES | C[C@@H]1C[NH+](C)[C@@H](C)C[C@@]1(OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-16-15-22(3)17(2)14-21(16,19-12-8-5-9-13-19)24-20(23)18-10-6-4-7-11-18/h4-13,16-17H,14-15H2,1-3H3/p+1/t16-,17+,21+/m1/s1 |
| InChIKey | ADUJECNUNSENPU-WWMYMODYSA-O |
| XLogP | 2.68 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |