C23H29NO2 — CID 2868081
(2,5-dimethyl-4-phenyl-1-propan-2-ylpiperidin-4-yl) benzoate (PubChem CID 2868081) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2,5-dimethyl-4-phenyl-1-propan-2-ylpiperidin-4-yl) benzoate.
| Compound Name | (2,5-dimethyl-4-phenyl-1-propan-2-ylpiperidin-4-yl) benzoate |
|---|---|
| PubChem CID | 2868081 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2,5-dimethyl-4-phenyl-1-propan-2-ylpiperidin-4-yl) benzoate |
| SMILES | CC(C)N1CC(C)C(OC(=O)c2ccccc2)(c2ccccc2)CC1C |
| InChI | InChI=1S/C23H29NO2/c1-17(2)24-16-18(3)23(15-19(24)4,21-13-9-6-10-14-21)26-22(25)20-11-7-5-8-12-20/h5-14,17-19H,15-16H2,1-4H3 |
| InChIKey | ISISUCXOWWQKPO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |