C17H25NO2 — CID 586831
(2,5-dimethyl-1-propan-2-ylpiperidin-4-yl) benzoate (PubChem CID 586831) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (2,5-dimethyl-1-propan-2-ylpiperidin-4-yl) benzoate.
| Compound Name | (2,5-dimethyl-1-propan-2-ylpiperidin-4-yl) benzoate |
|---|---|
| PubChem CID | 586831 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (2,5-dimethyl-1-propan-2-ylpiperidin-4-yl) benzoate |
| SMILES | CC1CN(C(C)C)C(C)CC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H25NO2/c1-12(2)18-11-13(3)16(10-14(18)4)20-17(19)15-8-6-5-7-9-15/h5-9,12-14,16H,10-11H2,1-4H3 |
| InChIKey | OCFLFQDQCLZABG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |