C34H50N2O4 — CID 70147210
(1,3-dimethyl-4-phenylazepan-4-yl) propanoate;[(2S,4S,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl] propanoate (PubChem CID 70147210) has the molecular formula C34H50N2O4 and a molecular weight of 550.78 g/mol. Its IUPAC name is (1,3-dimethyl-4-phenylazepan-4-yl) propanoate;[(2S,4S,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl] propanoate.
| Compound Name | (1,3-dimethyl-4-phenylazepan-4-yl) propanoate;[(2S,4S,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl] propanoate |
|---|---|
| PubChem CID | 70147210 |
| Molecular Formula | C34H50N2O4 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.38 |
| IUPAC Name | (1,3-dimethyl-4-phenylazepan-4-yl) propanoate;[(2S,4S,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl] propanoate |
| SMILES | CCC(=O)OC1(c2ccccc2)CCCN(C)CC1C.CCC(=O)O[C@@]1(c2ccccc2)C[C@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/2C17H25NO2/c1-5-16(19)20-17(15-9-7-6-8-10-15)11-14(3)18(4)12-13(17)2;1-4-16(19)20-17(15-9-6-5-7-10-15)11-8-12-18(3)13-14(17)2/h6-10,13-14H,5,11-12H2,1-4H3;5-7,9-10,14H,4,8,11-13H2,1-3H3/t13-,14+,17+;/m1./s1 |
| InChIKey | BFFCMVHBEVPXHU-RECIXLKMSA-N |
| XLogP | 6.39 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |