C25H29NO2 — CID 3049045
[2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate (PubChem CID 3049045) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate.
| Compound Name | [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate |
|---|---|
| PubChem CID | 3049045 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [2,5-dimethyl-4-phenyl-1-(3-phenylprop-2-ynyl)piperidin-4-yl] propanoate |
| SMILES | CCC(=O)OC1(c2ccccc2)CC(C)N(CC#Cc2ccccc2)CC1C |
| InChI | InChI=1S/C25H29NO2/c1-4-24(27)28-25(23-15-9-6-10-16-23)18-21(3)26(19-20(25)2)17-11-14-22-12-7-5-8-13-22/h5-10,12-13,15-16,20-21H,4,17-19H2,1-3H3 |
| InChIKey | SLHNLFIAXZQFIP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|