C22H27NO3 — CID 40529228
[(2S,4R,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl] 2-phenoxyacetate (PubChem CID 40529228) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is [(2S,4R,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl] 2-phenoxyacetate.
| Compound Name | [(2S,4R,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 40529228 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [(2S,4R,5R)-1,2,5-trimethyl-4-phenylpiperidin-4-yl] 2-phenoxyacetate |
| SMILES | C[C@@H]1CN(C)[C@@H](C)C[C@]1(OC(=O)COc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3/c1-17-15-23(3)18(2)14-22(17,19-10-6-4-7-11-19)26-21(24)16-25-20-12-8-5-9-13-20/h4-13,17-18H,14-16H2,1-3H3/t17-,18+,22-/m1/s1 |
| InChIKey | ORZSEJAIMNPLCR-KGVIQGDOSA-N |
| XLogP | 3.86 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |