C20H28NO3+ — CID 7320909
[4-[(2S,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-1-ium-4-yl]-2-methylbut-3-yn-2-yl] benzoate (PubChem CID 7320909) has the molecular formula C20H28NO3+ and a molecular weight of 330.45 g/mol. Its IUPAC name is [4-[(2S,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-1-ium-4-yl]-2-methylbut-3-yn-2-yl] benzoate.
| Compound Name | [4-[(2S,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-1-ium-4-yl]-2-methylbut-3-yn-2-yl] benzoate |
|---|---|
| PubChem CID | 7320909 |
| Molecular Formula | C20H28NO3+ |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | [4-[(2S,4S,5R)-4-hydroxy-1,2,5-trimethylpiperidin-1-ium-4-yl]-2-methylbut-3-yn-2-yl] benzoate |
| SMILES | C[C@@H]1C[NH+](C)[C@@H](C)C[C@@]1(O)C#CC(C)(C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c1-15-14-21(5)16(2)13-20(15,23)12-11-19(3,4)24-18(22)17-9-7-6-8-10-17/h6-10,15-16,23H,13-14H2,1-5H3/p+1/t15-,16+,20+/m1/s1 |
| InChIKey | VUEVYIBTFKAOPT-GUXCAODWSA-O |
| XLogP | 1.30 |
| TPSA | 50.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|