C26H30N2O — CID 57217591
(4aS)-4a-(3-methoxyphenyl)-9-methyl-2-prop-2-enyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole (PubChem CID 57217591) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (4aS)-4a-(3-methoxyphenyl)-9-methyl-2-prop-2-enyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole.
| Compound Name | (4aS)-4a-(3-methoxyphenyl)-9-methyl-2-prop-2-enyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole |
|---|---|
| PubChem CID | 57217591 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (4aS)-4a-(3-methoxyphenyl)-9-methyl-2-prop-2-enyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole |
| SMILES | C=CCN1CC[C@]2(c3cccc(OC)c3)Cc3[nH]c4ccc(C)cc4c3CC2C1 |
| InChI | InChI=1S/C26H30N2O/c1-4-11-28-12-10-26(19-6-5-7-21(14-19)29-3)16-25-23(15-20(26)17-28)22-13-18(2)8-9-24(22)27-25/h4-9,13-14,20,27H,1,10-12,15-17H2,2-3H3/t20?,26-/m1/s1 |
| InChIKey | WNPLSYODGXZPMY-NBXNUCLWSA-N |
| XLogP | 5.03 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|