C24H26N2O2 — CID 57143507
1-[(4aS)-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]ethanone (PubChem CID 57143507) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1-[(4aS)-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]ethanone.
| Compound Name | 1-[(4aS)-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]ethanone |
|---|---|
| PubChem CID | 57143507 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 1-[(4aS)-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]ethanone |
| SMILES | COc1cccc([C@]23CCN(C(C)=O)CC2Cc2c([nH]c4ccccc24)C3)c1 |
| InChI | InChI=1S/C24H26N2O2/c1-16(27)26-11-10-24(17-6-5-7-19(12-17)28-2)14-23-21(13-18(24)15-26)20-8-3-4-9-22(20)25-23/h3-9,12,18,25H,10-11,13-15H2,1-2H3/t18?,24-/m1/s1 |
| InChIKey | OXVJTDFHJHMSTJ-VCUSLETLSA-N |
| XLogP | 4.08 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|