C30H30N2O2 — CID 57068387
[(4aS)-4a-(3-methoxyphenyl)-10-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone (PubChem CID 57068387) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is [(4aS)-4a-(3-methoxyphenyl)-10-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone.
| Compound Name | [(4aS)-4a-(3-methoxyphenyl)-10-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 57068387 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | [(4aS)-4a-(3-methoxyphenyl)-10-methyl-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone |
| SMILES | COc1cccc([C@]23CCN(C(=O)c4ccccc4)CC2Cc2c([nH]c4cccc(C)c24)C3)c1 |
| InChI | InChI=1S/C30H30N2O2/c1-20-8-6-13-26-28(20)25-17-23-19-32(29(33)21-9-4-3-5-10-21)15-14-30(23,18-27(25)31-26)22-11-7-12-24(16-22)34-2/h3-13,16,23,31H,14-15,17-19H2,1-2H3/t23?,30-/m1/s1 |
| InChIKey | AQRRHTNSDKYTGG-JSTCWRMYSA-N |
| XLogP | 5.68 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |