C29H27N3O4 — CID 57144998
[(4aS)-4a-(3-methoxyphenyl)-9-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone (PubChem CID 57144998) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is [(4aS)-4a-(3-methoxyphenyl)-9-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone.
| Compound Name | [(4aS)-4a-(3-methoxyphenyl)-9-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 57144998 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | [(4aS)-4a-(3-methoxyphenyl)-9-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone |
| SMILES | COc1cccc([C@]23CCN(C(=O)c4ccccc4)CC2Cc2c([nH]c4ccc([N+](=O)[O-])cc24)C3)c1 |
| InChI | InChI=1S/C29H27N3O4/c1-36-23-9-5-8-20(14-23)29-12-13-31(28(33)19-6-3-2-4-7-19)18-21(29)15-24-25-16-22(32(34)35)10-11-26(25)30-27(24)17-29/h2-11,14,16,21,30H,12-13,15,17-18H2,1H3/t21?,29-/m1/s1 |
| InChIKey | OPLBZVRLPQYCJX-NLLRYDLESA-N |
| XLogP | 5.28 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|