C25H24Cl3N3O5 — CID 57269386
2,2,2-trichloroethyl (4aS)-4a-(3-methoxyphenyl)-9-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole-2-carboxylate (PubChem CID 57269386) has the molecular formula C25H24Cl3N3O5 and a molecular weight of 552.84 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (4aS)-4a-(3-methoxyphenyl)-9-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (4aS)-4a-(3-methoxyphenyl)-9-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole-2-carboxylate |
|---|---|
| PubChem CID | 57269386 |
| Molecular Formula | C25H24Cl3N3O5 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 551.08 |
| IUPAC Name | 2,2,2-trichloroethyl (4aS)-4a-(3-methoxyphenyl)-9-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole-2-carboxylate |
| SMILES | COc1cccc([C@]23CCN(C(=O)OCC(Cl)(Cl)Cl)CC2Cc2c([nH]c4ccc([N+](=O)[O-])cc24)C3)c1 |
| InChI | InChI=1S/C25H24Cl3N3O5/c1-35-18-4-2-3-15(9-18)24-7-8-30(23(32)36-14-25(26,27)28)13-16(24)10-19-20-11-17(31(33)34)5-6-21(20)29-22(19)12-24/h2-6,9,11,16,29H,7-8,10,12-14H2,1H3/t16?,24-/m1/s1 |
| InChIKey | CQKYWLXSXSBKPB-OODIQHKMSA-N |
| XLogP | 5.95 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|