C25H24Cl3FN2O3 — CID 19435260
2,2,2-trichloroethyl 10-fluoro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole-2-carboxylate (PubChem CID 19435260) has the molecular formula C25H24Cl3FN2O3 and a molecular weight of 525.84 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 10-fluoro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl 10-fluoro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole-2-carboxylate |
|---|---|
| PubChem CID | 19435260 |
| Molecular Formula | C25H24Cl3FN2O3 |
| Molecular Weight | 525.84 g/mol |
| Exact Mass | 524.08 |
| IUPAC Name | 2,2,2-trichloroethyl 10-fluoro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazole-2-carboxylate |
| SMILES | COc1cccc(C23CCN(C(=O)OCC(Cl)(Cl)Cl)CC2Cc2c([nH]c4cccc(F)c24)C3)c1 |
| InChI | InChI=1S/C25H24Cl3FN2O3/c1-33-17-5-2-4-15(10-17)24-8-9-31(23(32)34-14-25(26,27)28)13-16(24)11-18-21(12-24)30-20-7-3-6-19(29)22(18)20/h2-7,10,16,30H,8-9,11-14H2,1H3 |
| InChIKey | SGEQCXMKDMOEJK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.84 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|