C29H27FN2O2 — CID 19435607
[7-fluoro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone (PubChem CID 19435607) has the molecular formula C29H27FN2O2 and a molecular weight of 454.55 g/mol. Its IUPAC name is [7-fluoro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone.
| Compound Name | [7-fluoro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 19435607 |
| Molecular Formula | C29H27FN2O2 |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [7-fluoro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-phenylmethanone |
| SMILES | COc1cccc(C23CCN(C(=O)c4ccccc4)CC2Cc2c([nH]c4c(F)cccc24)C3)c1 |
| InChI | InChI=1S/C29H27FN2O2/c1-34-22-10-5-9-20(15-22)29-13-14-32(28(33)19-7-3-2-4-8-19)18-21(29)16-24-23-11-6-12-25(30)27(23)31-26(24)17-29/h2-12,15,21,31H,13-14,16-18H2,1H3 |
| InChIKey | QHPGLUZPAMVZEE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|