C26H27ClN2O2 — CID 57211394
[(4aS)-8-chloro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-cyclopropylmethanone (PubChem CID 57211394) has the molecular formula C26H27ClN2O2 and a molecular weight of 434.97 g/mol. Its IUPAC name is [(4aS)-8-chloro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-cyclopropylmethanone.
| Compound Name | [(4aS)-8-chloro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 57211394 |
| Molecular Formula | C26H27ClN2O2 |
| Molecular Weight | 434.97 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | [(4aS)-8-chloro-4a-(3-methoxyphenyl)-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-cyclopropylmethanone |
| SMILES | COc1cccc([C@]23CCN(C(=O)C4CC4)CC2Cc2c([nH]c4cc(Cl)ccc24)C3)c1 |
| InChI | InChI=1S/C26H27ClN2O2/c1-31-20-4-2-3-17(11-20)26-9-10-29(25(30)16-5-6-16)15-18(26)12-22-21-8-7-19(27)13-23(21)28-24(22)14-26/h2-4,7-8,11,13,16,18,28H,5-6,9-10,12,14-15H2,1H3/t18?,26-/m1/s1 |
| InChIKey | SXGMUSAZOXMKIQ-WQGFSJIWSA-N |
| XLogP | 5.12 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.97 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|