C26H27N3O4 — CID 57287232
[(4aS)-4a-(3-methoxyphenyl)-10-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-cyclopropylmethanone (PubChem CID 57287232) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is [(4aS)-4a-(3-methoxyphenyl)-10-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-cyclopropylmethanone.
| Compound Name | [(4aS)-4a-(3-methoxyphenyl)-10-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 57287232 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [(4aS)-4a-(3-methoxyphenyl)-10-nitro-3,4,5,6,11,11a-hexahydro-1H-pyrido[4,3-b]carbazol-2-yl]-cyclopropylmethanone |
| SMILES | COc1cccc([C@]23CCN(C(=O)C4CC4)CC2Cc2c([nH]c4cccc([N+](=O)[O-])c24)C3)c1 |
| InChI | InChI=1S/C26H27N3O4/c1-33-19-5-2-4-17(12-19)26-10-11-28(25(30)16-8-9-16)15-18(26)13-20-22(14-26)27-21-6-3-7-23(24(20)21)29(31)32/h2-7,12,16,18,27H,8-11,13-15H2,1H3/t18?,26-/m1/s1 |
| InChIKey | LIZHOWQCXROSMF-WQGFSJIWSA-N |
| XLogP | 4.38 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|