C26H36N2O2 — CID 21017816
[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl] 2-aminobenzoate (PubChem CID 21017816) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is [3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl] 2-aminobenzoate.
| Compound Name | [3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl] 2-aminobenzoate |
|---|---|
| PubChem CID | 21017816 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | [3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl] 2-aminobenzoate |
| SMILES | CCCCCCN1CC[C@](C)(c2cccc(OC(=O)c3ccccc3N)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C26H36N2O2/c1-4-5-6-9-16-28-17-15-26(3,20(2)19-28)21-11-10-12-22(18-21)30-25(29)23-13-7-8-14-24(23)27/h7-8,10-14,18,20H,4-6,9,15-17,19,27H2,1-3H3/t20-,26-/m0/s1 |
| InChIKey | NJKACFLVWNKZIB-FNZWTVRRSA-N |
| XLogP | 5.67 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|