C20H33NO — CID 18404418
3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol (PubChem CID 18404418) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol.
| Compound Name | 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol |
|---|---|
| PubChem CID | 18404418 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol |
| SMILES | CCCCCCN1CCC(C)(c2cccc(O)c2C)C(C)C1 |
| InChI | InChI=1S/C20H33NO/c1-5-6-7-8-13-21-14-12-20(4,16(2)15-21)18-10-9-11-19(22)17(18)3/h9-11,16,22H,5-8,12-15H2,1-4H3 |
| InChIKey | BEPFGICGAXBHLI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|