About 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol
3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol (PubChem CID 18404418) has the molecular formula C20H33NO
and a molecular weight of 303.49 g/mol. Its IUPAC name is 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol.
Molecular Properties
| Compound Name | 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol |
| PubChem CID | 18404418 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol |
| SMILES | CCCCCCN1CCC(C)(c2cccc(O)c2C)C(C)C1 |
| InChI | InChI=1S/C20H33NO/c1-5-6-7-8-13-21-14-12-20(4,16(2)15-21)18-10-9-11-19(22)17(18)3/h9-11,16,22H,5-8,12-15H2,1-4H3 |
| InChIKey | BEPFGICGAXBHLI-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol?
The IUPAC name of 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol (CID 18404418) is 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol.
What is the SMILES notation for 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol?
The canonical SMILES for 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol is CCCCCCN1CCC(C)(c2cccc(O)c2C)C(C)C1.
What is the InChIKey of 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol?
The InChIKey is BEPFGICGAXBHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33NO/c1-5-6-7-8-13-21-14-12-20(4,16(2)15-21)18-10-9-11-19(22)17(18)3/h9-11,16,22H,5-8,12-15H2,1-4H3.
What are the key properties of 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol?
3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol has a molecular weight of 303.49 g/mol, XLogP of 4.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hexyl-3,4-dimethylpiperidin-4-yl)-2-methylphenol is sourced from PubChem (CID 18404418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).