C19H28Cl3NO — CID 22897383
2,4,6-trichloro-3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol (PubChem CID 22897383) has the molecular formula C19H28Cl3NO and a molecular weight of 392.80 g/mol. Its IUPAC name is 2,4,6-trichloro-3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol.
| Compound Name | 2,4,6-trichloro-3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol |
|---|---|
| PubChem CID | 22897383 |
| Molecular Formula | C19H28Cl3NO |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | 2,4,6-trichloro-3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol |
| SMILES | CCCCCCN1CC[C@](C)(c2c(Cl)cc(Cl)c(O)c2Cl)[C@@H](C)C1 |
| InChI | InChI=1S/C19H28Cl3NO/c1-4-5-6-7-9-23-10-8-19(3,13(2)12-23)16-14(20)11-15(21)18(24)17(16)22/h11,13,24H,4-10,12H2,1-3H3/t13-,19-/m0/s1 |
| InChIKey | WJFGEICZJXLCBT-DJJJIMSYSA-N |
| XLogP | 6.53 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|