C22H38N2O — CID 22897406
2-[(dimethylamino)methyl]-5-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol (PubChem CID 22897406) has the molecular formula C22H38N2O and a molecular weight of 346.56 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-5-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol.
| Compound Name | 2-[(dimethylamino)methyl]-5-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol |
|---|---|
| PubChem CID | 22897406 |
| Molecular Formula | C22H38N2O |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.30 |
| IUPAC Name | 2-[(dimethylamino)methyl]-5-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenol |
| SMILES | CCCCCCN1CC[C@](C)(c2ccc(CN(C)C)c(O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C22H38N2O/c1-6-7-8-9-13-24-14-12-22(3,18(2)16-24)20-11-10-19(17-23(4)5)21(25)15-20/h10-11,15,18,25H,6-9,12-14,16-17H2,1-5H3/t18-,22-/m0/s1 |
| InChIKey | DSIDYLWDTOEJFK-AVRDEDQJSA-N |
| XLogP | 4.63 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|