C26H46N2O2S — CID 21355969
N-[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl]heptane-1-sulfonamide (PubChem CID 21355969) has the molecular formula C26H46N2O2S and a molecular weight of 450.73 g/mol. Its IUPAC name is N-[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl]heptane-1-sulfonamide.
| Compound Name | N-[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl]heptane-1-sulfonamide |
|---|---|
| PubChem CID | 21355969 |
| Molecular Formula | C26H46N2O2S |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | N-[3-[(3R,4S)-1-hexyl-3,4-dimethylpiperidin-4-yl]phenyl]heptane-1-sulfonamide |
| SMILES | CCCCCCCS(=O)(=O)Nc1cccc([C@@]2(C)CCN(CCCCCC)C[C@@H]2C)c1 |
| InChI | InChI=1S/C26H46N2O2S/c1-5-7-9-11-13-20-31(29,30)27-25-16-14-15-24(21-25)26(4)17-19-28(22-23(26)3)18-12-10-8-6-2/h14-16,21,23,27H,5-13,17-20,22H2,1-4H3/t23-,26-/m0/s1 |
| InChIKey | NCQKRGMEKJXKPR-OZXSUGGESA-N |
| XLogP | 6.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|