C21H33F3N2O2S — CID 23001078
2,2,2-trifluoro-N-[3-(1-hexyl-3,4-dimethylpiperidin-4-yl)phenyl]ethanesulfonamide (PubChem CID 23001078) has the molecular formula C21H33F3N2O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-(1-hexyl-3,4-dimethylpiperidin-4-yl)phenyl]ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-[3-(1-hexyl-3,4-dimethylpiperidin-4-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 23001078 |
| Molecular Formula | C21H33F3N2O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-(1-hexyl-3,4-dimethylpiperidin-4-yl)phenyl]ethanesulfonamide |
| SMILES | CCCCCCN1CCC(C)(c2cccc(NS(=O)(=O)CC(F)(F)F)c2)C(C)C1 |
| InChI | InChI=1S/C21H33F3N2O2S/c1-4-5-6-7-12-26-13-11-20(3,17(2)15-26)18-9-8-10-19(14-18)25-29(27,28)16-21(22,23)24/h8-10,14,17,25H,4-7,11-13,15-16H2,1-3H3 |
| InChIKey | BYBZAGYTXBAPDA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|