C20H31N3O2S — CID 21355990
N-[3-[(3R,4S)-1-(5-cyanopentyl)-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide (PubChem CID 21355990) has the molecular formula C20H31N3O2S and a molecular weight of 377.55 g/mol. Its IUPAC name is N-[3-[(3R,4S)-1-(5-cyanopentyl)-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(3R,4S)-1-(5-cyanopentyl)-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 21355990 |
| Molecular Formula | C20H31N3O2S |
| Molecular Weight | 377.55 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-[3-[(3R,4S)-1-(5-cyanopentyl)-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide |
| SMILES | C[C@H]1CN(CCCCCC#N)CC[C@]1(C)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H31N3O2S/c1-17-16-23(13-7-5-4-6-12-21)14-11-20(17,2)18-9-8-10-19(15-18)22-26(3,24)25/h8-10,15,17,22H,4-7,11,13-14,16H2,1-3H3/t17-,20-/m0/s1 |
| InChIKey | VRHZGAZDBPYXGE-PXNSSMCTSA-N |
| XLogP | 3.74 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|