C23H34N2O2S — CID 91380224
N-[3-[(3R,4S)-1-(6,6-dimethylhept-2-en-4-ynyl)-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide (PubChem CID 91380224) has the molecular formula C23H34N2O2S and a molecular weight of 402.60 g/mol. Its IUPAC name is N-[3-[(3R,4S)-1-(6,6-dimethylhept-2-en-4-ynyl)-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[(3R,4S)-1-(6,6-dimethylhept-2-en-4-ynyl)-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 91380224 |
| Molecular Formula | C23H34N2O2S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-[3-[(3R,4S)-1-(6,6-dimethylhept-2-en-4-ynyl)-3,4-dimethylpiperidin-4-yl]phenyl]methanesulfonamide |
| SMILES | C[C@H]1CN(CC=CC#CC(C)(C)C)CC[C@]1(C)c1cccc(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H34N2O2S/c1-19-18-25(15-9-7-8-13-22(2,3)4)16-14-23(19,5)20-11-10-12-21(17-20)24-28(6,26)27/h7,9-12,17,19,24H,14-16,18H2,1-6H3/t19-,23-/m0/s1 |
| InChIKey | GHMAXIOOJJMZMK-CVDCTZTESA-N |
| XLogP | 4.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|