C21H32N4 — CID 22707937
1-hexyl-3,4-dimethyl-4-[3-(1H-1,2,4-triazol-5-yl)phenyl]piperidine (PubChem CID 22707937) has the molecular formula C21H32N4 and a molecular weight of 340.52 g/mol. Its IUPAC name is 1-hexyl-3,4-dimethyl-4-[3-(1H-1,2,4-triazol-5-yl)phenyl]piperidine.
| Compound Name | 1-hexyl-3,4-dimethyl-4-[3-(1H-1,2,4-triazol-5-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 22707937 |
| Molecular Formula | C21H32N4 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 1-hexyl-3,4-dimethyl-4-[3-(1H-1,2,4-triazol-5-yl)phenyl]piperidine |
| SMILES | CCCCCCN1CCC(C)(c2cccc(-c3ncn[nH]3)c2)C(C)C1 |
| InChI | InChI=1S/C21H32N4/c1-4-5-6-7-12-25-13-11-21(3,17(2)15-25)19-10-8-9-18(14-19)20-22-16-23-24-20/h8-10,14,16-17H,4-7,11-13,15H2,1-3H3,(H,22,23,24) |
| InChIKey | BDEAINVHYFQZLW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|