C24H30N4O — CID 22707944
3,4-dimethyl-1-(3-phenoxypropyl)-4-[3-(2H-triazol-4-yl)phenyl]piperidine (PubChem CID 22707944) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 3,4-dimethyl-1-(3-phenoxypropyl)-4-[3-(2H-triazol-4-yl)phenyl]piperidine.
| Compound Name | 3,4-dimethyl-1-(3-phenoxypropyl)-4-[3-(2H-triazol-4-yl)phenyl]piperidine |
|---|---|
| PubChem CID | 22707944 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3,4-dimethyl-1-(3-phenoxypropyl)-4-[3-(2H-triazol-4-yl)phenyl]piperidine |
| SMILES | CC1CN(CCCOc2ccccc2)CCC1(C)c1cccc(-c2cn[nH]n2)c1 |
| InChI | InChI=1S/C24H30N4O/c1-19-18-28(13-7-15-29-22-10-4-3-5-11-22)14-12-24(19,2)21-9-6-8-20(16-21)23-17-25-27-26-23/h3-6,8-11,16-17,19H,7,12-15,18H2,1-2H3,(H,25,26,27) |
| InChIKey | HATMPMBZYIPMLJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|