C24H29F2N3O — CID 18433196
2-(difluoromethyl)-6-[3,4-dimethyl-1-(3-phenoxypropyl)piperidin-4-yl]-1H-benzimidazole (PubChem CID 18433196) has the molecular formula C24H29F2N3O and a molecular weight of 413.51 g/mol. Its IUPAC name is 2-(difluoromethyl)-6-[3,4-dimethyl-1-(3-phenoxypropyl)piperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-(difluoromethyl)-6-[3,4-dimethyl-1-(3-phenoxypropyl)piperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 18433196 |
| Molecular Formula | C24H29F2N3O |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 2-(difluoromethyl)-6-[3,4-dimethyl-1-(3-phenoxypropyl)piperidin-4-yl]-1H-benzimidazole |
| SMILES | CC1CN(CCCOc2ccccc2)CCC1(C)c1ccc2nc(C(F)F)[nH]c2c1 |
| InChI | InChI=1S/C24H29F2N3O/c1-17-16-29(12-6-14-30-19-7-4-3-5-8-19)13-11-24(17,2)18-9-10-20-21(15-18)28-23(27-20)22(25)26/h3-5,7-10,15,17,22H,6,11-14,16H2,1-2H3,(H,27,28) |
| InChIKey | ZSPVKCKKCCUDAT-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|