C31H45N3O3 — CID 53339293
(3R)-7-hydroxy-N-[(2S,3S)-1-[(3R,4S)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]-3-methyl-2,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 53339293) has the molecular formula C31H45N3O3 and a molecular weight of 507.72 g/mol. Its IUPAC name is (3R)-7-hydroxy-N-[(2S,3S)-1-[(3R,4S)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]-3-methyl-2,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3R)-7-hydroxy-N-[(2S,3S)-1-[(3R,4S)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]-3-methyl-2,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 53339293 |
| Molecular Formula | C31H45N3O3 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.35 |
| IUPAC Name | (3R)-7-hydroxy-N-[(2S,3S)-1-[(3R,4S)-4-(3-methoxyphenyl)-3,4-dimethylpiperidin-1-yl]-3-methylpentan-2-yl]-3-methyl-2,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC[C@H](C)[C@@H](CN1CC[C@](C)(c2cccc(OC)c2)[C@@H](C)C1)NC(=O)[C@@]1(C)Cc2ccc(O)cc2CN1 |
| InChI | InChI=1S/C31H45N3O3/c1-7-21(2)28(33-29(36)31(5)17-23-11-12-26(35)15-24(23)18-32-31)20-34-14-13-30(4,22(3)19-34)25-9-8-10-27(16-25)37-6/h8-12,15-16,21-22,28,32,35H,7,13-14,17-20H2,1-6H3,(H,33,36)/t21-,22-,28+,30-,31+/m0/s1 |
| InChIKey | DAJWTURPBVTSIB-ISKAXAHMSA-N |
| XLogP | 4.64 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |