C29H40N2O3 — CID 58408526
(3S)-3-[[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-1-[(3R)-7-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-methylpentan-1-one (PubChem CID 58408526) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is (3S)-3-[[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-1-[(3R)-7-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-methylpentan-1-one.
| Compound Name | (3S)-3-[[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-1-[(3R)-7-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 58408526 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | (3S)-3-[[(3R,4R)-4-(3-hydroxyphenyl)-3,4-dimethylpiperidin-1-yl]methyl]-1-[(3R)-7-hydroxy-1,2,3,4-tetrahydroisoquinolin-3-yl]-4-methylpentan-1-one |
| SMILES | CC(C)[C@H](CC(=O)[C@H]1Cc2ccc(O)cc2CN1)CN1CC[C@@](C)(c2cccc(O)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C29H40N2O3/c1-19(2)23(14-28(34)27-13-21-8-9-26(33)12-22(21)16-30-27)18-31-11-10-29(4,20(3)17-31)24-6-5-7-25(32)15-24/h5-9,12,15,19-20,23,27,30,32-33H,10-11,13-14,16-18H2,1-4H3/t20-,23+,27+,29+/m0/s1 |
| InChIKey | ZUHWYYKWDRXTRE-ZDGQEMPXSA-N |
| XLogP | 4.64 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |