C22H27NO2 — CID 22645405
methyl 3-(1-benzyl-3,4-dimethylpiperidin-4-yl)benzoate (PubChem CID 22645405) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is methyl 3-(1-benzyl-3,4-dimethylpiperidin-4-yl)benzoate.
| Compound Name | methyl 3-(1-benzyl-3,4-dimethylpiperidin-4-yl)benzoate |
|---|---|
| PubChem CID | 22645405 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | methyl 3-(1-benzyl-3,4-dimethylpiperidin-4-yl)benzoate |
| SMILES | COC(=O)c1cccc(C2(C)CCN(Cc3ccccc3)CC2C)c1 |
| InChI | InChI=1S/C22H27NO2/c1-17-15-23(16-18-8-5-4-6-9-18)13-12-22(17,2)20-11-7-10-19(14-20)21(24)25-3/h4-11,14,17H,12-13,15-16H2,1-3H3 |
| InChIKey | YAOBUDWULXAPCT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |